C15H20F6O7S3 — CID 118265463
2-[[3,3-bis(hydroxymethyl)-1,5-dithiaspiro[5.5]undecan-11-yl]oxycarbonyl]-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid (PubChem CID 118265463) has the molecular formula C15H20F6O7S3 and a molecular weight of 522.51 g/mol. Its IUPAC name is 2-[[3,3-bis(hydroxymethyl)-1,5-dithiaspiro[5.5]undecan-11-yl]oxycarbonyl]-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid.
| Compound Name | 2-[[3,3-bis(hydroxymethyl)-1,5-dithiaspiro[5.5]undecan-11-yl]oxycarbonyl]-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
|---|---|
| PubChem CID | 118265463 |
| Molecular Formula | C15H20F6O7S3 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 2-[[3,3-bis(hydroxymethyl)-1,5-dithiaspiro[5.5]undecan-11-yl]oxycarbonyl]-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
| SMILES | O=C(OC1CCCCC12SCC(CO)(CO)CS2)C(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C15H20F6O7S3/c16-14(17,18)13(15(19,20)21,31(25,26)27)10(24)28-9-3-1-2-4-12(9)29-7-11(5-22,6-23)8-30-12/h9,22-23H,1-8H2,(H,25,26,27) |
| InChIKey | LXFMBPFNPSARCW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|