C16H13N — CID 118265475
tricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8,10,12,15-octaen-14-amine (PubChem CID 118265475) has the molecular formula C16H13N and a molecular weight of 219.29 g/mol. Its IUPAC name is tricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8,10,12,15-octaen-14-amine.
| Compound Name | tricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8,10,12,15-octaen-14-amine |
|---|---|
| PubChem CID | 118265475 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | tricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8,10,12,15-octaen-14-amine |
| SMILES | Nc1cccccc2cccc3ccc1cc23 |
| InChI | InChI=1S/C16H13N/c17-16-8-3-1-2-5-12-6-4-7-13-9-10-14(16)11-15(12)13/h1-11H,17H2/b2-1-,3-1-,5-2-,8-3-,12-5-,16-8+,16-14+ |
| InChIKey | UPMQKYWMRIWHLL-KDKZFRQWSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |