C20H15F3N8O2 — CID 11826577
1-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 11826577) has the molecular formula C20H15F3N8O2 and a molecular weight of 456.39 g/mol. Its IUPAC name is 1-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 11826577 |
| Molecular Formula | C20H15F3N8O2 |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CCn1cc2c(nc(NC(=O)Nc3ccc(C(F)(F)F)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C20H15F3N8O2/c1-2-30-10-13-15(28-30)26-18(31-17(13)25-16(29-31)14-4-3-9-33-14)27-19(32)24-12-7-5-11(6-8-12)20(21,22)23/h3-10H,2H2,1H3,(H2,24,26,27,28,32) |
| InChIKey | APLSVTYFWKNRKK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |