C26H24N4O4 — CID 11826581
4-(3,4-dimethoxyphenyl)-2-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 11826581) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 11826581 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(c3ccc(-c4ccc(=O)[nH]n4)cc3)C(=O)C3CC=CCC23)cc1OC |
| InChI | InChI=1S/C26H24N4O4/c1-33-22-13-9-17(15-23(22)34-2)25-19-5-3-4-6-20(19)26(32)30(29-25)18-10-7-16(8-11-18)21-12-14-24(31)28-27-21/h3-4,7-15,19-20H,5-6H2,1-2H3,(H,28,31) |
| InChIKey | JBMNQTIIWJVUPM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 96.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|