C19H22N8O2S2 — CID 118266020
3-[2-(5-aminopentylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 118266020) has the molecular formula C19H22N8O2S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 3-[2-(5-aminopentylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 3-[2-(5-aminopentylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118266020 |
| Molecular Formula | C19H22N8O2S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 3-[2-(5-aminopentylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | NCCCCCNc1nc2c(-c3cccc(S(N)(=O)=O)c3-c3nn[nH]n3)cccc2s1 |
| InChI | InChI=1S/C19H22N8O2S2/c20-10-2-1-3-11-22-19-23-17-13(7-4-8-14(17)30-19)12-6-5-9-15(31(21,28)29)16(12)18-24-26-27-25-18/h4-9H,1-3,10-11,20H2,(H,22,23)(H2,21,28,29)(H,24,25,26,27) |
| InChIKey | SDXRYHFOGSJJMI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 165.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|