C18H20N8O2S2 — CID 118266581
3-[2-(4-aminobutylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 118266581) has the molecular formula C18H20N8O2S2 and a molecular weight of 444.55 g/mol. Its IUPAC name is 3-[2-(4-aminobutylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 3-[2-(4-aminobutylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118266581 |
| Molecular Formula | C18H20N8O2S2 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 3-[2-(4-aminobutylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | NCCCCNc1nc2c(-c3cccc(S(N)(=O)=O)c3-c3nn[nH]n3)cccc2s1 |
| InChI | InChI=1S/C18H20N8O2S2/c19-9-1-2-10-21-18-22-16-12(6-3-7-13(16)29-18)11-5-4-8-14(30(20,27)28)15(11)17-23-25-26-24-17/h3-8H,1-2,9-10,19H2,(H,21,22)(H2,20,27,28)(H,23,24,25,26) |
| InChIKey | WBGUXJCBSVWMJO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 165.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|