C19H21N7O3S2 — CID 118266652
3-(2-amino-1,3-benzothiazol-4-yl)-6-(5-hydroxypentyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 118266652) has the molecular formula C19H21N7O3S2 and a molecular weight of 459.56 g/mol. Its IUPAC name is 3-(2-amino-1,3-benzothiazol-4-yl)-6-(5-hydroxypentyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 3-(2-amino-1,3-benzothiazol-4-yl)-6-(5-hydroxypentyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118266652 |
| Molecular Formula | C19H21N7O3S2 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 3-(2-amino-1,3-benzothiazol-4-yl)-6-(5-hydroxypentyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | Nc1nc2c(-c3ccc(CCCCCO)c(S(N)(=O)=O)c3-c3nn[nH]n3)cccc2s1 |
| InChI | InChI=1S/C19H21N7O3S2/c20-19-22-16-13(6-4-7-14(16)30-19)12-9-8-11(5-2-1-3-10-27)17(31(21,28)29)15(12)18-23-25-26-24-18/h4,6-9,27H,1-3,5,10H2,(H2,20,22)(H2,21,28,29)(H,23,24,25,26) |
| InChIKey | YEXSMPGVXBWSMW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|