C20H21N7O2S2 — CID 118266689
3-[2-(cyclohexylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 118266689) has the molecular formula C20H21N7O2S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 3-[2-(cyclohexylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 3-[2-(cyclohexylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118266689 |
| Molecular Formula | C20H21N7O2S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 3-[2-(cyclohexylamino)-1,3-benzothiazol-4-yl]-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-c2cccc3sc(NC4CCCCC4)nc23)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C20H21N7O2S2/c21-31(28,29)16-11-5-8-13(17(16)19-24-26-27-25-19)14-9-4-10-15-18(14)23-20(30-15)22-12-6-2-1-3-7-12/h4-5,8-12H,1-3,6-7H2,(H,22,23)(H2,21,28,29)(H,24,25,26,27) |
| InChIKey | UHQZXDPGZMYCBL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |