C26H27N3O5 — CID 11826672
N-benzyl-N-[2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-2-(5-methyl-2,6-dioxo-3H-pyridin-3-yl)acetamide (PubChem CID 11826672) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-benzyl-N-[2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-2-(5-methyl-2,6-dioxo-3H-pyridin-3-yl)acetamide.
| Compound Name | N-benzyl-N-[2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-2-(5-methyl-2,6-dioxo-3H-pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 11826672 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-benzyl-N-[2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-2-(5-methyl-2,6-dioxo-3H-pyridin-3-yl)acetamide |
| SMILES | CC1=CC(CC(=O)N(CCN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@@H]3C2)Cc2ccccc2)C(=O)NC1=O |
| InChI | InChI=1S/C26H27N3O5/c1-15-11-19(24(32)27-23(15)31)13-20(30)28(14-16-5-3-2-4-6-16)9-10-29-25(33)21-17-7-8-18(12-17)22(21)26(29)34/h2-8,11,17-19,21-22H,9-10,12-14H2,1H3,(H,27,31,32)/t17-,18+,19?,21+,22- |
| InChIKey | LTXKQQLJZBHDDM-XKQWQMIMSA-N |
| XLogP | 1.43 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|