C24H50O6Si — CID 11826692
[(2R,4S,5S,6S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate (PubChem CID 11826692) has the molecular formula C24H50O6Si and a molecular weight of 462.74 g/mol. Its IUPAC name is [(2R,4S,5S,6S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,4S,5S,6S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11826692 |
| Molecular Formula | C24H50O6Si |
| Molecular Weight | 462.74 g/mol |
| Exact Mass | 462.34 |
| IUPAC Name | [(2R,4S,5S,6S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H](C[C@@H](C)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@@H](C)COC(=O)C(C)(C)C)OC |
| InChI | InChI=1S/C24H50O6Si/c1-17(15-25)13-19(27-9)21(30-31(11,12)24(6,7)8)20(28-10)14-18(2)16-29-22(26)23(3,4)5/h17-21,25H,13-16H2,1-12H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | KRKBCMCSYMKZMY-MJCUULBUSA-N |
| XLogP | 5.04 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.74 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|