C16H17N5O2 — CID 118267663
(E)-2-cyano-4-(2-cyclopentyloxy-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enamide (PubChem CID 118267663) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is (E)-2-cyano-4-(2-cyclopentyloxy-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enamide.
| Compound Name | (E)-2-cyano-4-(2-cyclopentyloxy-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enamide |
|---|---|
| PubChem CID | 118267663 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (E)-2-cyano-4-(2-cyclopentyloxy-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enamide |
| SMILES | N#C/C(=C\Cc1c[nH]c2ncc(OC3CCCC3)nc12)C(N)=O |
| InChI | InChI=1S/C16H17N5O2/c17-7-10(15(18)22)5-6-11-8-19-16-14(11)21-13(9-20-16)23-12-3-1-2-4-12/h5,8-9,12H,1-4,6H2,(H2,18,22)(H,19,20)/b10-5+ |
| InChIKey | GMOAEMPXNUNMFI-BJMVGYQFSA-N |
| XLogP | 1.76 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|