C19H17F3N4O3 — CID 118267738
(E)-3-[5-[6-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 118267738) has the molecular formula C19H17F3N4O3 and a molecular weight of 406.36 g/mol. Its IUPAC name is (E)-3-[5-[6-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-[6-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118267738 |
| Molecular Formula | C19H17F3N4O3 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (E)-3-[5-[6-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1c[nH]c2ncc(-c3ccc(=O)n(CCOCC(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C19H17F3N4O3/c20-19(21,22)11-29-6-5-26-10-13(2-4-17(26)28)14-7-15-12(1-3-16(23)27)8-24-18(15)25-9-14/h1-4,7-10H,5-6,11H2,(H2,23,27)(H,24,25)/b3-1+ |
| InChIKey | SYEFSUPOBSIYHZ-HNQUOIGGSA-N |
| XLogP | 2.47 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|