About diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane
diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane (PubChem CID 11826812) has the molecular formula C28H31NP2Si
and a molecular weight of 471.60 g/mol. Its IUPAC name is diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane.
Molecular Properties
| Compound Name | diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane |
| PubChem CID | 11826812 |
| Molecular Formula | C28H31NP2Si |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane |
| SMILES | C[Si](C)(C)N=P(CP(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NP2Si/c1-32(2,3)29-31(27-20-12-6-13-21-27,28-22-14-7-15-23-28)24-30(25-16-8-4-9-17-25)26-18-10-5-11-19-26/h4-23H,24H2,1-3H3 |
| InChIKey | UQZINWMGVAWVDX-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane?
The IUPAC name of diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane (CID 11826812) is diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane.
What is the SMILES notation for diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane?
The canonical SMILES for diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane is C[Si](C)(C)N=P(CP(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane?
The InChIKey is UQZINWMGVAWVDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31NP2Si/c1-32(2,3)29-31(27-20-12-6-13-21-27,28-22-14-7-15-23-28)24-30(25-16-8-4-9-17-25)26-18-10-5-11-19-26/h4-23H,24H2,1-3H3.
What are the key properties of diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane?
diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane has a molecular weight of 471.60 g/mol, XLogP of 6.76, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphanylmethyl-diphenyl-trimethylsilylimino-lambda5-phosphane is sourced from PubChem (CID 11826812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).