About anthracene;cyclohexa-2,5-diene-1,4-dione
anthracene;cyclohexa-2,5-diene-1,4-dione (PubChem CID 118268436) has the molecular formula C20H14O2
and a molecular weight of 286.33 g/mol. Its IUPAC name is anthracene;cyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | anthracene;cyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 118268436 |
| Molecular Formula | C20H14O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | anthracene;cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C=C1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C6H4O2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-5-1-2-6(8)4-3-5/h1-10H;1-4H |
| InChIKey | ZSBPNVMRYGMTAX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;cyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;cyclohexa-2,5-diene-1,4-dione?
The IUPAC name of anthracene;cyclohexa-2,5-diene-1,4-dione (CID 118268436) is anthracene;cyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for anthracene;cyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for anthracene;cyclohexa-2,5-diene-1,4-dione is O=C1C=CC(=O)C=C1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;cyclohexa-2,5-diene-1,4-dione?
The InChIKey is ZSBPNVMRYGMTAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C6H4O2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-5-1-2-6(8)4-3-5/h1-10H;1-4H.
What are the key properties of anthracene;cyclohexa-2,5-diene-1,4-dione?
anthracene;cyclohexa-2,5-diene-1,4-dione has a molecular weight of 286.33 g/mol, XLogP of 4.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;cyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 118268436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).