[3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate

C11H9F2NO4 — CID 118269060

IUPAC[3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate
SMILESCC1(OC(=O)O)CC(c2cc(F)ccc2F)=NO1
InChIInChI=1S/C11H9F2NO4/c1-11(17-10(15)16)5-9(14-18-11)7-4-6(12)2-3-8(7)13/h2-4H,5H2,1H3,(H,15,16)
InChIKeyCJNRMZXEFQNXHT-UHFFFAOYSA-N
MW257.19 g/mol
LogP2.50
Rot. Bonds2

About [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate

[3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate (PubChem CID 118269060) has the molecular formula C11H9F2NO4 and a molecular weight of 257.19 g/mol. Its IUPAC name is [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate.

Molecular Properties

Compound Name[3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate
PubChem CID118269060
Molecular FormulaC11H9F2NO4
Molecular Weight257.19 g/mol
Exact Mass257.05
IUPAC Name[3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate
SMILESCC1(OC(=O)O)CC(c2cc(F)ccc2F)=NO1
InChIInChI=1S/C11H9F2NO4/c1-11(17-10(15)16)5-9(14-18-11)7-4-6(12)2-3-8(7)13/h2-4H,5H2,1H3,(H,15,16)
InChIKeyCJNRMZXEFQNXHT-UHFFFAOYSA-N
XLogP2.50
TPSA68.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.19
LogP ≤ 52.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate?
The IUPAC name of [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate (CID 118269060) is [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate.
What is the SMILES notation for [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate?
The canonical SMILES for [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate is CC1(OC(=O)O)CC(c2cc(F)ccc2F)=NO1.
What is the InChIKey of [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate?
The InChIKey is CJNRMZXEFQNXHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO4/c1-11(17-10(15)16)5-9(14-18-11)7-4-6(12)2-3-8(7)13/h2-4H,5H2,1H3,(H,15,16).
What are the key properties of [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate?
[3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate has a molecular weight of 257.19 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,5-difluorophenyl)-5-methyl-4H-1,2-oxazol-5-yl] hydrogen carbonate is sourced from PubChem (CID 118269060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).