About 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene
1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene (PubChem CID 118269554) has the molecular formula C10H8F3NO3
and a molecular weight of 247.17 g/mol. Its IUPAC name is 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene.
Molecular Properties
| Compound Name | 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene |
| PubChem CID | 118269554 |
| Molecular Formula | C10H8F3NO3 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene |
| SMILES | C=Cc1cccc(OCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8F3NO3/c1-2-7-4-3-5-8(9(7)14(15)16)17-6-10(11,12)13/h2-5H,1,6H2 |
| InChIKey | OGBAJORKABYKOV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene?
The IUPAC name of 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene (CID 118269554) is 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene.
What is the SMILES notation for 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene?
The canonical SMILES for 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene is C=Cc1cccc(OCC(F)(F)F)c1[N+](=O)[O-].
What is the InChIKey of 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene?
The InChIKey is OGBAJORKABYKOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO3/c1-2-7-4-3-5-8(9(7)14(15)16)17-6-10(11,12)13/h2-5H,1,6H2.
What are the key properties of 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene?
1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene has a molecular weight of 247.17 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-nitro-3-(2,2,2-trifluoroethoxy)benzene is sourced from PubChem (CID 118269554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).