C11H16N4O6 — CID 118269855
[(3S,4R,7S)-3-methoxy-7-(4-nitro-1H-pyrazol-5-yl)oxepan-4-yl]carbamic acid (PubChem CID 118269855) has the molecular formula C11H16N4O6 and a molecular weight of 300.27 g/mol. Its IUPAC name is [(3S,4R,7S)-3-methoxy-7-(4-nitro-1H-pyrazol-5-yl)oxepan-4-yl]carbamic acid.
| Compound Name | [(3S,4R,7S)-3-methoxy-7-(4-nitro-1H-pyrazol-5-yl)oxepan-4-yl]carbamic acid |
|---|---|
| PubChem CID | 118269855 |
| Molecular Formula | C11H16N4O6 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [(3S,4R,7S)-3-methoxy-7-(4-nitro-1H-pyrazol-5-yl)oxepan-4-yl]carbamic acid |
| SMILES | CO[C@@H]1CO[C@H](c2[nH]ncc2[N+](=O)[O-])CC[C@H]1NC(=O)O |
| InChI | InChI=1S/C11H16N4O6/c1-20-9-5-21-8(3-2-6(9)13-11(16)17)10-7(15(18)19)4-12-14-10/h4,6,8-9,13H,2-3,5H2,1H3,(H,12,14)(H,16,17)/t6-,8+,9-/m1/s1 |
| InChIKey | FGMBPMFYNPGECX-BWVDBABLSA-N |
| XLogP | 0.82 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|