C23H30ClIN4O2S — CID 118269894
2-[(4-chlorophenyl)carbamoylamino]-6-(cyclohexylmethyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide (PubChem CID 118269894) has the molecular formula C23H30ClIN4O2S and a molecular weight of 588.94 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-6-(cyclohexylmethyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-6-(cyclohexylmethyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide |
|---|---|
| PubChem CID | 118269894 |
| Molecular Formula | C23H30ClIN4O2S |
| Molecular Weight | 588.94 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-6-(cyclohexylmethyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide |
| SMILES | C[N+]1(CC2CCCCC2)CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3)c2C(N)=O)C1.[I-] |
| InChI | InChI=1S/C23H29ClN4O2S.HI/c1-28(13-15-5-3-2-4-6-15)12-11-18-19(14-28)31-22(20(18)21(25)29)27-23(30)26-17-9-7-16(24)8-10-17;/h7-10,15H,2-6,11-14H2,1H3,(H3-,25,26,27,29,30);1H |
| InChIKey | ZQZBMWPMOTZQKR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.94 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|