C24H22F3N5O3 — CID 118270009
(E)-1-[(3aR,7aR)-5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 118270009) has the molecular formula C24H22F3N5O3 and a molecular weight of 485.47 g/mol. Its IUPAC name is (E)-1-[(3aR,7aR)-5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[(3aR,7aR)-5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118270009 |
| Molecular Formula | C24H22F3N5O3 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | (E)-1-[(3aR,7aR)-5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)(F)F)cc1)N1C[C@@H]2CN(C(=O)c3ccc4n[nH]nc4c3)CC[C@H]2C1 |
| InChI | InChI=1S/C24H22F3N5O3/c25-24(26,27)35-19-5-1-15(2-6-19)3-8-22(33)32-12-17-9-10-31(13-18(17)14-32)23(34)16-4-7-20-21(11-16)29-30-28-20/h1-8,11,17-18H,9-10,12-14H2,(H,28,29,30)/b8-3+/t17-,18-/m0/s1 |
| InChIKey | LAHAZVKTDIUJQM-FEFNXVNYSA-N |
| XLogP | 3.49 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|