C23H22F3N5O4 — CID 118270070
[4-(trifluoromethoxy)phenyl]methyl (3aS,6aS)-2-(4-methyl-2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 118270070) has the molecular formula C23H22F3N5O4 and a molecular weight of 489.45 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl]methyl (3aS,6aS)-2-(4-methyl-2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | [4-(trifluoromethoxy)phenyl]methyl (3aS,6aS)-2-(4-methyl-2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 118270070 |
| Molecular Formula | C23H22F3N5O4 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl]methyl (3aS,6aS)-2-(4-methyl-2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | Cc1c(C(=O)N2C[C@H]3CN(C(=O)OCc4ccc(OC(F)(F)F)cc4)C[C@@H]3C2)ccc2n[nH]nc12 |
| InChI | InChI=1S/C23H22F3N5O4/c1-13-18(6-7-19-20(13)28-29-27-19)21(32)30-8-15-10-31(11-16(15)9-30)22(33)34-12-14-2-4-17(5-3-14)35-23(24,25)26/h2-7,15-16H,8-12H2,1H3,(H,27,28,29)/t15-,16-/m0/s1 |
| InChIKey | OJRPQQBPAWHEEP-HOTGVXAUSA-N |
| XLogP | 3.51 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |