About 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole
3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole (PubChem CID 118270118) has the molecular formula C12H17N3O4
and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole.
Molecular Properties
| Compound Name | 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole |
| PubChem CID | 118270118 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole |
| SMILES | CCC1CC2(CC2)OC(c2n[nH]c(C)c2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C12H17N3O4/c1-3-8-6-12(4-5-12)19-11(18-8)9-10(15(16)17)7(2)13-14-9/h8,11H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | ZSRBJUASLXEQCU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole?
The IUPAC name of 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole (CID 118270118) is 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole.
What is the SMILES notation for 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole?
The canonical SMILES for 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole is CCC1CC2(CC2)OC(c2n[nH]c(C)c2[N+](=O)[O-])O1.
What is the InChIKey of 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole?
The InChIKey is ZSRBJUASLXEQCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c1-3-8-6-12(4-5-12)19-11(18-8)9-10(15(16)17)7(2)13-14-9/h8,11H,3-6H2,1-2H3,(H,13,14).
What are the key properties of 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole?
3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole has a molecular weight of 267.28 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-ethyl-4,6-dioxaspiro[2.5]octan-5-yl)-5-methyl-4-nitro-1H-pyrazole is sourced from PubChem (CID 118270118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).