C24H24N6O4 — CID 118270433
(4-cyano-2-ethoxyphenyl)methyl (3aS,6aS)-2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 118270433) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is (4-cyano-2-ethoxyphenyl)methyl (3aS,6aS)-2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (4-cyano-2-ethoxyphenyl)methyl (3aS,6aS)-2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 118270433 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (4-cyano-2-ethoxyphenyl)methyl (3aS,6aS)-2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CCOc1cc(C#N)ccc1COC(=O)N1C[C@@H]2CN(C(=O)c3ccc4n[nH]nc4c3)C[C@H]2C1 |
| InChI | InChI=1S/C24H24N6O4/c1-2-33-22-7-15(9-25)3-4-17(22)14-34-24(32)30-12-18-10-29(11-19(18)13-30)23(31)16-5-6-20-21(8-16)27-28-26-20/h3-8,18-19H,2,10-14H2,1H3,(H,26,27,28)/t18-,19-/m0/s1 |
| InChIKey | SXYSIHXUTNMGIJ-OALUTQOASA-N |
| XLogP | 2.57 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |