C23H21F4N5O3 — CID 118270460
1-[(3aR,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]propan-1-one (PubChem CID 118270460) has the molecular formula C23H21F4N5O3 and a molecular weight of 491.45 g/mol. Its IUPAC name is 1-[(3aR,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]propan-1-one.
| Compound Name | 1-[(3aR,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 118270460 |
| Molecular Formula | C23H21F4N5O3 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 1-[(3aR,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]propan-1-one |
| SMILES | O=C(CCc1ccc(OC(F)(F)F)c(F)c1)N1C[C@@H]2CN(C(=O)c3ccc4n[nH]nc4c3)C[C@H]2C1 |
| InChI | InChI=1S/C23H21F4N5O3/c24-17-7-13(1-5-20(17)35-23(25,26)27)2-6-21(33)31-9-15-11-32(12-16(15)10-31)22(34)14-3-4-18-19(8-14)29-30-28-18/h1,3-5,7-8,15-16H,2,6,9-12H2,(H,28,29,30)/t15-,16-/m1/s1 |
| InChIKey | UOJHNYNMRWUBDB-HZPDHXFCSA-N |
| XLogP | 3.16 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |