C22H21Cl2N5O2 — CID 118270503
1-[(3aS,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(3,5-dichlorophenyl)propan-1-one (PubChem CID 118270503) has the molecular formula C22H21Cl2N5O2 and a molecular weight of 458.35 g/mol. Its IUPAC name is 1-[(3aS,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(3,5-dichlorophenyl)propan-1-one.
| Compound Name | 1-[(3aS,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(3,5-dichlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 118270503 |
| Molecular Formula | C22H21Cl2N5O2 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 1-[(3aS,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(3,5-dichlorophenyl)propan-1-one |
| SMILES | O=C(CCc1cc(Cl)cc(Cl)c1)N1C[C@@H]2CN(C(=O)c3ccc4n[nH]nc4c3)C[C@@H]2C1 |
| InChI | InChI=1S/C22H21Cl2N5O2/c23-17-5-13(6-18(24)8-17)1-4-21(30)28-9-15-11-29(12-16(15)10-28)22(31)14-2-3-19-20(7-14)26-27-25-19/h2-3,5-8,15-16H,1,4,9-12H2,(H,25,26,27)/t15-,16+ |
| InChIKey | CRBLYFVTCRENGL-IYBDPMFKSA-N |
| XLogP | 3.43 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |