C15H15N3O2 — CID 118270548
methyl 5-cyano-3-(1,4-dimethylpyrazol-5-yl)-2-methylbenzoate (PubChem CID 118270548) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 5-cyano-3-(1,4-dimethylpyrazol-5-yl)-2-methylbenzoate.
| Compound Name | methyl 5-cyano-3-(1,4-dimethylpyrazol-5-yl)-2-methylbenzoate |
|---|---|
| PubChem CID | 118270548 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | methyl 5-cyano-3-(1,4-dimethylpyrazol-5-yl)-2-methylbenzoate |
| SMILES | COC(=O)c1cc(C#N)cc(-c2c(C)cnn2C)c1C |
| InChI | InChI=1S/C15H15N3O2/c1-9-8-17-18(3)14(9)12-5-11(7-16)6-13(10(12)2)15(19)20-4/h5-6,8H,1-4H3 |
| InChIKey | PSUUWNOCOKOMLQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |