About [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium
[(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium (PubChem CID 11827058) has the molecular formula C22H21NO2P+
and a molecular weight of 362.39 g/mol. Its IUPAC name is [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium.
Molecular Properties
| Compound Name | [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium |
| PubChem CID | 11827058 |
| Molecular Formula | C22H21NO2P+ |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium |
| SMILES | O=C1N[C@H](C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)CO1 |
| InChI | InChI=1S/C22H20NO2P/c24-22-23-18(16-25-22)17-26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,18H,16-17H2/p+1/t18-/m0/s1 |
| InChIKey | QERQOHBVCJHRLF-SFHVURJKSA-O |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium?
The IUPAC name of [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium (CID 11827058) is [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium.
What is the SMILES notation for [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium?
The canonical SMILES for [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium is O=C1N[C@H](C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)CO1.
What is the InChIKey of [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium?
The InChIKey is QERQOHBVCJHRLF-SFHVURJKSA-O. The full InChI is InChI=1S/C22H20NO2P/c24-22-23-18(16-25-22)17-26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,18H,16-17H2/p+1/t18-/m0/s1.
What are the key properties of [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium?
[(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium has a molecular weight of 362.39 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl-triphenylphosphanium is sourced from PubChem (CID 11827058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).