About 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole
5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole (PubChem CID 118270652) has the molecular formula C10H12F2N6O3
and a molecular weight of 302.24 g/mol. Its IUPAC name is 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole |
| PubChem CID | 118270652 |
| Molecular Formula | C10H12F2N6O3 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole |
| SMILES | [N-]=[N+]=NC1COC(Cc2[nH]ncc2[N+](=O)[O-])CC(F)(F)C1 |
| InChI | InChI=1S/C10H12F2N6O3/c11-10(12)2-6(15-17-13)5-21-7(3-10)1-8-9(18(19)20)4-14-16-8/h4,6-7H,1-3,5H2,(H,14,16) |
| InChIKey | PKYBFXQYKMHYOS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole?
The IUPAC name of 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole (CID 118270652) is 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole.
What is the SMILES notation for 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole?
The canonical SMILES for 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole is [N-]=[N+]=NC1COC(Cc2[nH]ncc2[N+](=O)[O-])CC(F)(F)C1.
What is the InChIKey of 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole?
The InChIKey is PKYBFXQYKMHYOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N6O3/c11-10(12)2-6(15-17-13)5-21-7(3-10)1-8-9(18(19)20)4-14-16-8/h4,6-7H,1-3,5H2,(H,14,16).
What are the key properties of 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole?
5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole has a molecular weight of 302.24 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-azido-4,4-difluorooxepan-2-yl)methyl]-4-nitro-1H-pyrazole is sourced from PubChem (CID 118270652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).