About 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole
5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole (PubChem CID 118270760) has the molecular formula C10H13N3O4
and a molecular weight of 239.23 g/mol. Its IUPAC name is 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole |
| PubChem CID | 118270760 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole |
| SMILES | O=[N+]([O-])c1cn[nH]c1CC1CCC2OC2CO1 |
| InChI | InChI=1S/C10H13N3O4/c14-13(15)8-4-11-12-7(8)3-6-1-2-9-10(17-9)5-16-6/h4,6,9-10H,1-3,5H2,(H,11,12) |
| InChIKey | IQLZQGFTZCLJRA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole?
The IUPAC name of 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole (CID 118270760) is 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole.
What is the SMILES notation for 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole?
The canonical SMILES for 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole is O=[N+]([O-])c1cn[nH]c1CC1CCC2OC2CO1.
What is the InChIKey of 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole?
The InChIKey is IQLZQGFTZCLJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O4/c14-13(15)8-4-11-12-7(8)3-6-1-2-9-10(17-9)5-16-6/h4,6,9-10H,1-3,5H2,(H,11,12).
What are the key properties of 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole?
5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole has a molecular weight of 239.23 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,8-dioxabicyclo[5.1.0]octan-4-ylmethyl)-4-nitro-1H-pyrazole is sourced from PubChem (CID 118270760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).