C28H26FNO6 — CID 11827084
2-[(2S,3R,4R,5S,6R)-2-fluoro-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 11827084) has the molecular formula C28H26FNO6 and a molecular weight of 491.52 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S,6R)-2-fluoro-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R,4R,5S,6R)-2-fluoro-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11827084 |
| Molecular Formula | C28H26FNO6 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-[(2S,3R,4R,5S,6R)-2-fluoro-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1[C@@H](OCc2ccccc2)[C@H](O)[C@@H](COCc2ccccc2)O[C@H]1F |
| InChI | InChI=1S/C28H26FNO6/c29-26-23(30-27(32)20-13-7-8-14-21(20)28(30)33)25(35-16-19-11-5-2-6-12-19)24(31)22(36-26)17-34-15-18-9-3-1-4-10-18/h1-14,22-26,31H,15-17H2/t22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | JPKUOKCXFIRLEH-ZFXZZAOISA-N |
| XLogP | 3.51 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|