C12H9F3N2O3S — CID 118271487
4-(2-oxo-1,3,4-oxathiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 118271487) has the molecular formula C12H9F3N2O3S and a molecular weight of 318.28 g/mol. Its IUPAC name is 4-(2-oxo-1,3,4-oxathiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 4-(2-oxo-1,3,4-oxathiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 118271487 |
| Molecular Formula | C12H9F3N2O3S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-(2-oxo-1,3,4-oxathiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | O=C(NCCC(F)(F)F)c1ccc(-c2nsc(=O)o2)cc1 |
| InChI | InChI=1S/C12H9F3N2O3S/c13-12(14,15)5-6-16-9(18)7-1-3-8(4-2-7)10-17-21-11(19)20-10/h1-4H,5-6H2,(H,16,18) |
| InChIKey | XGBPNINRMSNHOG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |