About 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one
1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one (PubChem CID 118271511) has the molecular formula C19H16N4OS
and a molecular weight of 348.43 g/mol. Its IUPAC name is 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one |
| PubChem CID | 118271511 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one |
| SMILES | CCn1c(=O)c(-c2ccccc2)cc2cnc(Nc3nccs3)cc21 |
| InChI | InChI=1S/C19H16N4OS/c1-2-23-16-11-17(22-19-20-8-9-25-19)21-12-14(16)10-15(18(23)24)13-6-4-3-5-7-13/h3-12H,2H2,1H3,(H,20,21,22) |
| InChIKey | PMJUMPMHTIKJNZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one?
The IUPAC name of 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one (CID 118271511) is 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one.
What is the SMILES notation for 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one?
The canonical SMILES for 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one is CCn1c(=O)c(-c2ccccc2)cc2cnc(Nc3nccs3)cc21.
What is the InChIKey of 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one?
The InChIKey is PMJUMPMHTIKJNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4OS/c1-2-23-16-11-17(22-19-20-8-9-25-19)21-12-14(16)10-15(18(23)24)13-6-4-3-5-7-13/h3-12H,2H2,1H3,(H,20,21,22).
What are the key properties of 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one?
1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one has a molecular weight of 348.43 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-phenyl-7-(1,3-thiazol-2-ylamino)-1,6-naphthyridin-2-one is sourced from PubChem (CID 118271511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).