C33H30F3N7O3 — CID 118271924
1-(7,8-dihydroxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2-[4-[4-methyl-6-[[4-(trifluoromethyl)-2-pyridinyl]amino]-2-pyridinyl]triazol-1-yl]propan-1-one (PubChem CID 118271924) has the molecular formula C33H30F3N7O3 and a molecular weight of 629.64 g/mol. Its IUPAC name is 1-(7,8-dihydroxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2-[4-[4-methyl-6-[[4-(trifluoromethyl)-2-pyridinyl]amino]-2-pyridinyl]triazol-1-yl]propan-1-one.
| Compound Name | 1-(7,8-dihydroxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2-[4-[4-methyl-6-[[4-(trifluoromethyl)-2-pyridinyl]amino]-2-pyridinyl]triazol-1-yl]propan-1-one |
|---|---|
| PubChem CID | 118271924 |
| Molecular Formula | C33H30F3N7O3 |
| Molecular Weight | 629.64 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | 1-(7,8-dihydroxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2-[4-[4-methyl-6-[[4-(trifluoromethyl)-2-pyridinyl]amino]-2-pyridinyl]triazol-1-yl]propan-1-one |
| SMILES | Cc1cc(Nc2cc(C(F)(F)F)ccn2)nc(-c2cn(C(C)C(=O)N3CCc4cc(O)c(O)cc4C(c4ccccc4)C3)nn2)c1 |
| InChI | InChI=1S/C33H30F3N7O3/c1-19-12-26(38-31(13-19)39-30-15-23(8-10-37-30)33(34,35)36)27-18-43(41-40-27)20(2)32(46)42-11-9-22-14-28(44)29(45)16-24(22)25(17-42)21-6-4-3-5-7-21/h3-8,10,12-16,18,20,25,44-45H,9,11,17H2,1-2H3,(H,37,38,39) |
| InChIKey | YWMDYNGWTSVQLE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|