C20H24N6O3 — CID 118271987
1-[3-(2-methoxyethoxy)-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-[(3R,4S)-4-phenylpyrrolidin-3-yl]urea (PubChem CID 118271987) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-[(3R,4S)-4-phenylpyrrolidin-3-yl]urea.
| Compound Name | 1-[3-(2-methoxyethoxy)-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-[(3R,4S)-4-phenylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 118271987 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-[(3R,4S)-4-phenylpyrrolidin-3-yl]urea |
| SMILES | COCCOc1n[nH]c2cc(NC(=O)N[C@H]3CNC[C@@H]3c3ccccc3)ncc12 |
| InChI | InChI=1S/C20H24N6O3/c1-28-7-8-29-19-15-11-22-18(9-16(15)25-26-19)24-20(27)23-17-12-21-10-14(17)13-5-3-2-4-6-13/h2-6,9,11,14,17,21H,7-8,10,12H2,1H3,(H,25,26)(H2,22,23,24,27)/t14-,17+/m1/s1 |
| InChIKey | AVOPERJFBVGMAY-PBHICJAKSA-N |
| XLogP | 1.86 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|