About 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one
6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one (PubChem CID 118272301) has the molecular formula C25H18ClN3O
and a molecular weight of 411.89 g/mol. Its IUPAC name is 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one.
Molecular Properties
| Compound Name | 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one |
| PubChem CID | 118272301 |
| Molecular Formula | C25H18ClN3O |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one |
| SMILES | O=c1[nH]n(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C25H18ClN3O/c26-23-16-22-21(17-27-23)24(30)28-29(22)25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H,(H,28,30) |
| InChIKey | RZPUFSGJEWAMHW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one?
The IUPAC name of 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one (CID 118272301) is 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one.
What is the SMILES notation for 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one?
The canonical SMILES for 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one is O=c1[nH]n(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(Cl)ncc12.
What is the InChIKey of 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one?
The InChIKey is RZPUFSGJEWAMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18ClN3O/c26-23-16-22-21(17-27-23)24(30)28-29(22)25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H,(H,28,30).
What are the key properties of 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one?
6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one has a molecular weight of 411.89 g/mol, XLogP of 5.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-trityl-2H-pyrazolo[4,3-c]pyridin-3-one is sourced from PubChem (CID 118272301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).