About 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide
3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide (PubChem CID 11827247) has the molecular formula C25H23BrN6O
and a molecular weight of 503.40 g/mol. Its IUPAC name is 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide |
| PubChem CID | 11827247 |
| Molecular Formula | C25H23BrN6O |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(CNC(=O)c2c(Br)c3ccccc3n2Cc2cccc(/C(N)=N/[H])c2)c1 |
| InChI | InChI=1S/C25H23BrN6O/c26-21-19-9-1-2-10-20(19)32(14-16-6-4-8-18(12-16)24(29)30)22(21)25(33)31-13-15-5-3-7-17(11-15)23(27)28/h1-12H,13-14H2,(H3,27,28)(H3,29,30)(H,31,33) |
| InChIKey | NVOVMNVSNWBIRX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide?
The IUPAC name of 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide (CID 11827247) is 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide.
What is the SMILES notation for 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide?
The canonical SMILES for 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide is [H]/N=C(\N)c1cccc(CNC(=O)c2c(Br)c3ccccc3n2Cc2cccc(/C(N)=N/[H])c2)c1.
What is the InChIKey of 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide?
The InChIKey is NVOVMNVSNWBIRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23BrN6O/c26-21-19-9-1-2-10-20(19)32(14-16-6-4-8-18(12-16)24(29)30)22(21)25(33)31-13-15-5-3-7-17(11-15)23(27)28/h1-12H,13-14H2,(H3,27,28)(H3,29,30)(H,31,33).
What are the key properties of 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide?
3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide has a molecular weight of 503.40 g/mol, XLogP of 3.95, 7 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]indole-2-carboxamide is sourced from PubChem (CID 11827247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).