C19H20N4OS — CID 118273149
N-cyclopentyl-4-(8-methylsulfanylimidazo[1,2-a]pyrazin-3-yl)benzamide (PubChem CID 118273149) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is N-cyclopentyl-4-(8-methylsulfanylimidazo[1,2-a]pyrazin-3-yl)benzamide.
| Compound Name | N-cyclopentyl-4-(8-methylsulfanylimidazo[1,2-a]pyrazin-3-yl)benzamide |
|---|---|
| PubChem CID | 118273149 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-cyclopentyl-4-(8-methylsulfanylimidazo[1,2-a]pyrazin-3-yl)benzamide |
| SMILES | CSc1nccn2c(-c3ccc(C(=O)NC4CCCC4)cc3)cnc12 |
| InChI | InChI=1S/C19H20N4OS/c1-25-19-17-21-12-16(23(17)11-10-20-19)13-6-8-14(9-7-13)18(24)22-15-4-2-3-5-15/h6-12,15H,2-5H2,1H3,(H,22,24) |
| InChIKey | XZHBXDVDOZOWQV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |