C21H20F3N3O4S — CID 118273377
N-(4-methylsulfonylbutyl)-6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline-2-carboxamide (PubChem CID 118273377) has the molecular formula C21H20F3N3O4S and a molecular weight of 467.47 g/mol. Its IUPAC name is N-(4-methylsulfonylbutyl)-6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline-2-carboxamide.
| Compound Name | N-(4-methylsulfonylbutyl)-6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 118273377 |
| Molecular Formula | C21H20F3N3O4S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-(4-methylsulfonylbutyl)-6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline-2-carboxamide |
| SMILES | CS(=O)(=O)CCCCNC(=O)c1ccc2cc(Oc3ccc(C(F)(F)F)cn3)ccc2n1 |
| InChI | InChI=1S/C21H20F3N3O4S/c1-32(29,30)11-3-2-10-25-20(28)18-7-4-14-12-16(6-8-17(14)27-18)31-19-9-5-15(13-26-19)21(22,23)24/h4-9,12-13H,2-3,10-11H2,1H3,(H,25,28) |
| InChIKey | OXTDNKQCDUKFHM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|