C22H19F3N4O3 — CID 118273807
(4-methoxyiminopiperidin-1-yl)-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone (PubChem CID 118273807) has the molecular formula C22H19F3N4O3 and a molecular weight of 444.41 g/mol. Its IUPAC name is (4-methoxyiminopiperidin-1-yl)-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone.
| Compound Name | (4-methoxyiminopiperidin-1-yl)-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone |
|---|---|
| PubChem CID | 118273807 |
| Molecular Formula | C22H19F3N4O3 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (4-methoxyiminopiperidin-1-yl)-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone |
| SMILES | CON=C1CCN(C(=O)c2ccc3cc(Oc4ccc(C(F)(F)F)cn4)ccc3n2)CC1 |
| InChI | InChI=1S/C22H19F3N4O3/c1-31-28-16-8-10-29(11-9-16)21(30)19-5-2-14-12-17(4-6-18(14)27-19)32-20-7-3-15(13-26-20)22(23,24)25/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | HDVADOYYGYXCJT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|