C23H21F3N4O2 — CID 118273860
[(3aR,4S,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone (PubChem CID 118273860) has the molecular formula C23H21F3N4O2 and a molecular weight of 442.44 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone.
| Compound Name | [(3aR,4S,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone |
|---|---|
| PubChem CID | 118273860 |
| Molecular Formula | C23H21F3N4O2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [(3aR,4S,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone |
| SMILES | N[C@H]1CC[C@@H]2CN(C(=O)c3ccc4cc(Oc5ccc(C(F)(F)F)cn5)ccc4n3)C[C@@H]21 |
| InChI | InChI=1S/C23H21F3N4O2/c24-23(25,26)15-3-8-21(28-10-15)32-16-4-7-19-13(9-16)2-6-20(29-19)22(31)30-11-14-1-5-18(27)17(14)12-30/h2-4,6-10,14,17-18H,1,5,11-12,27H2/t14-,17+,18+/m1/s1 |
| InChIKey | JASOGYNCKLULCT-JLSDUUJJSA-N |
| XLogP | 4.25 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |