C21H19F2N3O3S — CID 118273912
6-[[5-(difluoromethyl)-2-pyridinyl]oxy]-N-(1-oxothian-4-yl)quinoline-2-carboxamide (PubChem CID 118273912) has the molecular formula C21H19F2N3O3S and a molecular weight of 431.46 g/mol. Its IUPAC name is 6-[[5-(difluoromethyl)-2-pyridinyl]oxy]-N-(1-oxothian-4-yl)quinoline-2-carboxamide.
| Compound Name | 6-[[5-(difluoromethyl)-2-pyridinyl]oxy]-N-(1-oxothian-4-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 118273912 |
| Molecular Formula | C21H19F2N3O3S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 6-[[5-(difluoromethyl)-2-pyridinyl]oxy]-N-(1-oxothian-4-yl)quinoline-2-carboxamide |
| SMILES | O=C(NC1CCS(=O)CC1)c1ccc2cc(Oc3ccc(C(F)F)cn3)ccc2n1 |
| InChI | InChI=1S/C21H19F2N3O3S/c22-20(23)14-2-6-19(24-12-14)29-16-3-5-17-13(11-16)1-4-18(26-17)21(27)25-15-7-9-30(28)10-8-15/h1-6,11-12,15,20H,7-10H2,(H,25,27) |
| InChIKey | VSLLCYNGJLPGNO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |