C32H42O4Si — CID 11827438
(3aR,4Z,6R,9S,9aR)-9-[(2R)-5-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-6-methyl-1,3a,6,7,9,9a-hexahydrocycloocta[c]furan-3,8-dione (PubChem CID 11827438) has the molecular formula C32H42O4Si and a molecular weight of 518.77 g/mol. Its IUPAC name is (3aR,4Z,6R,9S,9aR)-9-[(2R)-5-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-6-methyl-1,3a,6,7,9,9a-hexahydrocycloocta[c]furan-3,8-dione.
| Compound Name | (3aR,4Z,6R,9S,9aR)-9-[(2R)-5-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-6-methyl-1,3a,6,7,9,9a-hexahydrocycloocta[c]furan-3,8-dione |
|---|---|
| PubChem CID | 11827438 |
| Molecular Formula | C32H42O4Si |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | (3aR,4Z,6R,9S,9aR)-9-[(2R)-5-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-6-methyl-1,3a,6,7,9,9a-hexahydrocycloocta[c]furan-3,8-dione |
| SMILES | C[C@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1C(=O)C[C@@H](C)/C=C\[C@H]2C(=O)OC[C@H]12 |
| InChI | InChI=1S/C32H42O4Si/c1-23-18-19-27-28(22-35-31(27)34)30(29(33)21-23)24(2)13-12-20-36-37(32(3,4)5,25-14-8-6-9-15-25)26-16-10-7-11-17-26/h6-11,14-19,23-24,27-28,30H,12-13,20-22H2,1-5H3/b19-18-/t23-,24+,27+,28-,30-/m0/s1 |
| InChIKey | WHALGWAIVCJURO-JYTVUAOMSA-N |
| XLogP | 5.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|