C24H26FN5O — CID 118274392
2-[5-(4-fluoro-8-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-11-yl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-dimethylacetamide (PubChem CID 118274392) has the molecular formula C24H26FN5O and a molecular weight of 419.50 g/mol. Its IUPAC name is 2-[5-(4-fluoro-8-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-11-yl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[5-(4-fluoro-8-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-11-yl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 118274392 |
| Molecular Formula | C24H26FN5O |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-[5-(4-fluoro-8-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-11-yl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCC=C(c2[nH]c3nccc4c3c2CN(C)c2ccc(F)cc2-4)C1 |
| InChI | InChI=1S/C24H26FN5O/c1-28(2)21(31)14-30-10-4-5-15(12-30)23-19-13-29(3)20-7-6-16(25)11-18(20)17-8-9-26-24(27-23)22(17)19/h5-9,11H,4,10,12-14H2,1-3H3,(H,26,27) |
| InChIKey | UNDAAOCZXBUKJT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|