C32H28F8N6O4S — CID 118274749
cis-(1R,2S)-2-N-[5-(difluoromethyl)-8-[1-(4-methylphenyl)sulfonyl-6-(trifluoromethyl)indol-3-yl]pyrido[4,3-d]pyrimidin-2-yl]cyclohexane-1,2-diamine;2,2,2-trifluoroacetic acid (PubChem CID 118274749) has the molecular formula C32H28F8N6O4S and a molecular weight of 744.67 g/mol. Its IUPAC name is cis-(1R,2S)-2-N-[5-(difluoromethyl)-8-[1-(4-methylphenyl)sulfonyl-6-(trifluoromethyl)indol-3-yl]pyrido[4,3-d]pyrimidin-2-yl]cyclohexane-1,2-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | cis-(1R,2S)-2-N-[5-(difluoromethyl)-8-[1-(4-methylphenyl)sulfonyl-6-(trifluoromethyl)indol-3-yl]pyrido[4,3-d]pyrimidin-2-yl]cyclohexane-1,2-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118274749 |
| Molecular Formula | C32H28F8N6O4S |
| Molecular Weight | 744.67 g/mol |
| Exact Mass | 744.18 |
| IUPAC Name | cis-(1R,2S)-2-N-[5-(difluoromethyl)-8-[1-(4-methylphenyl)sulfonyl-6-(trifluoromethyl)indol-3-yl]pyrido[4,3-d]pyrimidin-2-yl]cyclohexane-1,2-diamine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3cnc(C(F)F)c4cnc(N[C@H]5CCCC[C@H]5N)nc34)c3ccc(C(F)(F)F)cc32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H27F5N6O2S.C2HF3O2/c1-16-6-9-18(10-7-16)44(42,43)41-15-22(19-11-8-17(12-25(19)41)30(33,34)35)20-13-37-27(28(31)32)21-14-38-29(40-26(20)21)39-24-5-3-2-4-23(24)36;3-2(4,5)1(6)7/h6-15,23-24,28H,2-5,36H2,1H3,(H,38,39,40);(H,6,7)/t23-,24+;/m1./s1 |
| InChIKey | JPYPVTFXYHQFPM-ITNPDYSASA-N |
| XLogP | 7.46 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.67 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |