About 2-octylbenzotriazole-5,6-dicarbonitrile
2-octylbenzotriazole-5,6-dicarbonitrile (PubChem CID 118274780) has the molecular formula C16H19N5
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-octylbenzotriazole-5,6-dicarbonitrile.
Molecular Properties
| Compound Name | 2-octylbenzotriazole-5,6-dicarbonitrile |
| PubChem CID | 118274780 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-octylbenzotriazole-5,6-dicarbonitrile |
| SMILES | CCCCCCCCn1nc2cc(C#N)c(C#N)cc2n1 |
| InChI | InChI=1S/C16H19N5/c1-2-3-4-5-6-7-8-21-19-15-9-13(11-17)14(12-18)10-16(15)20-21/h9-10H,2-8H2,1H3 |
| InChIKey | UTFUKVFWWQKKOX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octylbenzotriazole-5,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylbenzotriazole-5,6-dicarbonitrile?
The IUPAC name of 2-octylbenzotriazole-5,6-dicarbonitrile (CID 118274780) is 2-octylbenzotriazole-5,6-dicarbonitrile.
What is the SMILES notation for 2-octylbenzotriazole-5,6-dicarbonitrile?
The canonical SMILES for 2-octylbenzotriazole-5,6-dicarbonitrile is CCCCCCCCn1nc2cc(C#N)c(C#N)cc2n1.
What is the InChIKey of 2-octylbenzotriazole-5,6-dicarbonitrile?
The InChIKey is UTFUKVFWWQKKOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5/c1-2-3-4-5-6-7-8-21-19-15-9-13(11-17)14(12-18)10-16(15)20-21/h9-10H,2-8H2,1H3.
What are the key properties of 2-octylbenzotriazole-5,6-dicarbonitrile?
2-octylbenzotriazole-5,6-dicarbonitrile has a molecular weight of 281.36 g/mol, XLogP of 3.54, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylbenzotriazole-5,6-dicarbonitrile is sourced from PubChem (CID 118274780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).