C13H15F2N3O2 — CID 118275346
2,2-difluoro-7-(5-nitro-2-pyridinyl)-7-azaspiro[3.5]nonane (PubChem CID 118275346) has the molecular formula C13H15F2N3O2 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2,2-difluoro-7-(5-nitro-2-pyridinyl)-7-azaspiro[3.5]nonane.
| Compound Name | 2,2-difluoro-7-(5-nitro-2-pyridinyl)-7-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 118275346 |
| Molecular Formula | C13H15F2N3O2 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2,2-difluoro-7-(5-nitro-2-pyridinyl)-7-azaspiro[3.5]nonane |
| SMILES | O=[N+]([O-])c1ccc(N2CCC3(CC2)CC(F)(F)C3)nc1 |
| InChI | InChI=1S/C13H15F2N3O2/c14-13(15)8-12(9-13)3-5-17(6-4-12)11-2-1-10(7-16-11)18(19)20/h1-2,7H,3-6,8-9H2 |
| InChIKey | YTBUGWVCVZLYLT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|