About 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one
8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one (PubChem CID 118275428) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one.
Molecular Properties
| Compound Name | 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one |
| PubChem CID | 118275428 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one |
| SMILES | O=C1CC2(C1)CC1CCC(C2)N1c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C15H17N3O3/c19-13-7-15(8-13)5-10-1-2-11(6-15)17(10)14-4-3-12(9-16-14)18(20)21/h3-4,9-11H,1-2,5-8H2 |
| InChIKey | PPXFTZAZDQSGKL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one?
The IUPAC name of 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one (CID 118275428) is 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one.
What is the SMILES notation for 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one?
The canonical SMILES for 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one is O=C1CC2(C1)CC1CCC(C2)N1c1ccc([N+](=O)[O-])cn1.
What is the InChIKey of 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one?
The InChIKey is PPXFTZAZDQSGKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3/c19-13-7-15(8-13)5-10-1-2-11(6-15)17(10)14-4-3-12(9-16-14)18(20)21/h3-4,9-11H,1-2,5-8H2.
What are the key properties of 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one?
8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one has a molecular weight of 287.32 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(5-nitro-2-pyridinyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-cyclobutane]-1'-one is sourced from PubChem (CID 118275428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).