About 1,1,15-tribromopentadecane
1,1,15-tribromopentadecane (PubChem CID 118275782) has the molecular formula C15H29Br3
and a molecular weight of 449.11 g/mol. Its IUPAC name is 1,1,15-tribromopentadecane.
Molecular Properties
| Compound Name | 1,1,15-tribromopentadecane |
| PubChem CID | 118275782 |
| Molecular Formula | C15H29Br3 |
| Molecular Weight | 449.11 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | 1,1,15-tribromopentadecane |
| SMILES | BrCCCCCCCCCCCCCCC(Br)Br |
| InChI | InChI=1S/C15H29Br3/c16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(17)18/h15H,1-14H2 |
| InChIKey | QRJHOBLVGXXNJR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.11 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1,15-tribromopentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,15-tribromopentadecane?
The IUPAC name of 1,1,15-tribromopentadecane (CID 118275782) is 1,1,15-tribromopentadecane.
What is the SMILES notation for 1,1,15-tribromopentadecane?
The canonical SMILES for 1,1,15-tribromopentadecane is BrCCCCCCCCCCCCCCC(Br)Br.
What is the InChIKey of 1,1,15-tribromopentadecane?
The InChIKey is QRJHOBLVGXXNJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29Br3/c16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(17)18/h15H,1-14H2.
What are the key properties of 1,1,15-tribromopentadecane?
1,1,15-tribromopentadecane has a molecular weight of 449.11 g/mol, XLogP of 7.57, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,15-tribromopentadecane is sourced from PubChem (CID 118275782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).