C29H48O7Si — CID 11827615
methyl (2'R,5'S,6'S,7'S,8'R,9'S,11'S,13'S)-5'-[tert-butyl(dimethyl)silyl]oxy-11'-ethoxy-6'-methylspiro[1,3-dioxolane-2,3'-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene]-8'-carboxylate (PubChem CID 11827615) has the molecular formula C29H48O7Si and a molecular weight of 536.78 g/mol. Its IUPAC name is methyl (2'R,5'S,6'S,7'S,8'R,9'S,11'S,13'S)-5'-[tert-butyl(dimethyl)silyl]oxy-11'-ethoxy-6'-methylspiro[1,3-dioxolane-2,3'-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene]-8'-carboxylate.
| Compound Name | methyl (2'R,5'S,6'S,7'S,8'R,9'S,11'S,13'S)-5'-[tert-butyl(dimethyl)silyl]oxy-11'-ethoxy-6'-methylspiro[1,3-dioxolane-2,3'-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene]-8'-carboxylate |
|---|---|
| PubChem CID | 11827615 |
| Molecular Formula | C29H48O7Si |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | methyl (2'R,5'S,6'S,7'S,8'R,9'S,11'S,13'S)-5'-[tert-butyl(dimethyl)silyl]oxy-11'-ethoxy-6'-methylspiro[1,3-dioxolane-2,3'-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene]-8'-carboxylate |
| SMILES | CCO[C@@H]1C[C@@H]2CCCC3=C2[C@@H](O1)[C@H](C(=O)OC)[C@H]1[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)CC2(OCCO2)[C@@H]31 |
| InChI | InChI=1S/C29H48O7Si/c1-9-32-21-15-18-11-10-12-19-23(18)26(35-21)24(27(30)31-6)22-17(2)20(36-37(7,8)28(3,4)5)16-29(25(19)22)33-13-14-34-29/h17-18,20-22,24-26H,9-16H2,1-8H3/t17-,18+,20+,21+,22-,24-,25+,26-/m1/s1 |
| InChIKey | LWWBASCDVCOLQX-MHAVLHCYSA-N |
| XLogP | 5.44 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|