C5H7Cl3O3 — CID 118276167
3,3,4-trichloropent-1-ene-1,1,2-triol (PubChem CID 118276167) has the molecular formula C5H7Cl3O3 and a molecular weight of 221.47 g/mol. Its IUPAC name is 3,3,4-trichloropent-1-ene-1,1,2-triol.
| Compound Name | 3,3,4-trichloropent-1-ene-1,1,2-triol |
|---|---|
| PubChem CID | 118276167 |
| Molecular Formula | C5H7Cl3O3 |
| Molecular Weight | 221.47 g/mol |
| Exact Mass | 219.95 |
| IUPAC Name | 3,3,4-trichloropent-1-ene-1,1,2-triol |
| SMILES | CC(Cl)C(Cl)(Cl)C(O)=C(O)O |
| InChI | InChI=1S/C5H7Cl3O3/c1-2(6)5(7,8)3(9)4(10)11/h2,9-11H,1H3 |
| InChIKey | QPXSRJQOVIVFPR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|