About 3,6-dichlorohex-1-ene-1,1,2-triol
3,6-dichlorohex-1-ene-1,1,2-triol (PubChem CID 118276249) has the molecular formula C6H10Cl2O3
and a molecular weight of 201.05 g/mol. Its IUPAC name is 3,6-dichlorohex-1-ene-1,1,2-triol.
Molecular Properties
| Compound Name | 3,6-dichlorohex-1-ene-1,1,2-triol |
| PubChem CID | 118276249 |
| Molecular Formula | C6H10Cl2O3 |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 3,6-dichlorohex-1-ene-1,1,2-triol |
| SMILES | OC(O)=C(O)C(Cl)CCCCl |
| InChI | InChI=1S/C6H10Cl2O3/c7-3-1-2-4(8)5(9)6(10)11/h4,9-11H,1-3H2 |
| InChIKey | STGLFZUUBQPFDH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dichlorohex-1-ene-1,1,2-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichlorohex-1-ene-1,1,2-triol?
The IUPAC name of 3,6-dichlorohex-1-ene-1,1,2-triol (CID 118276249) is 3,6-dichlorohex-1-ene-1,1,2-triol.
What is the SMILES notation for 3,6-dichlorohex-1-ene-1,1,2-triol?
The canonical SMILES for 3,6-dichlorohex-1-ene-1,1,2-triol is OC(O)=C(O)C(Cl)CCCCl.
What is the InChIKey of 3,6-dichlorohex-1-ene-1,1,2-triol?
The InChIKey is STGLFZUUBQPFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl2O3/c7-3-1-2-4(8)5(9)6(10)11/h4,9-11H,1-3H2.
What are the key properties of 3,6-dichlorohex-1-ene-1,1,2-triol?
3,6-dichlorohex-1-ene-1,1,2-triol has a molecular weight of 201.05 g/mol, XLogP of 2.46, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichlorohex-1-ene-1,1,2-triol is sourced from PubChem (CID 118276249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).